CAS 63801-89-8

4'-methoxy-5-nitrobiphenyl-2-olate

Description:

4'-Methoxy-5-nitrobiphenyl-2-olate, with the CAS number 63801-89-8, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH3) at the para position and a nitro group (-NO2) at the meta position on one of the phenyl rings contributes to its chemical reactivity and polarity. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the presence of the methoxy group, which enhances its solubility compared to non-substituted biphenyls. Its nitro group can participate in electrophilic aromatic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit specific optical properties and potential biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive and potentially hazardous.

Formula: C₁₃H₁₀NO₄

InChI: InChI=1/C13H11NO4/c1-18-11-5-2-9(3-6-11)12-8-10(14(16)17)4-7-13(12)15/h2-8,15H,1H3/p-1

SMILES: COc1ccc(cc1)c1cc(ccc1O)N(=O)=O

Synonyms:

• 4'-Methoxy-5-Nitro-1,1'-Biphenyl-2-Ol

2-(4-Methoxyphenyl)-4-nitrophenol

CAS: 63801-89-8

Versatile small molecule scaffold

Formula: C₁₃H₁₁NO₄

Purity: Min. 95%

Molecular weight: 245.23 g/mol

Ref: 3D-NCA80189