CAS 63807-86-3

2H,6H-Benzo[1,2-b:5,4-b′]dipyran-6-one, 7-(4-hydroxyphenyl)-2,2-dimethyl-

Description:

2H,6H-Benzo[1,2-b:5,4-b′]dipyran-6-one, 7-(4-hydroxyphenyl)-2,2-dimethyl- is a synthetic organic compound characterized by its complex polycyclic structure, which includes a benzo-dipyran framework. This compound features a hydroxyl group (-OH) attached to a phenyl ring, contributing to its potential for hydrogen bonding and interactions with biological systems. The presence of two methyl groups at the 2-position enhances its lipophilicity, which may influence its solubility and biological activity. The compound is likely to exhibit various chemical properties, including stability under standard conditions, but may be sensitive to light or heat, depending on its specific functional groups. Its unique structure suggests potential applications in fields such as pharmaceuticals, where it may serve as a scaffold for drug development or as a dye due to its chromophoric properties. As with many organic compounds, its reactivity can be influenced by the presence of functional groups, making it a subject of interest for further research in organic synthesis and medicinal chemistry.

Formula: C₂₀H₁₆O₄

InChI: InChI=1S/C20H16O4/c1-20(2)8-7-13-9-15-18(10-17(13)24-20)23-11-16(19(15)22)12-3-5-14(21)6-4-12/h3-11,21H,1-2H3

InChI key: InChIKey=GGGQCONNJCHXIR-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC3=C(C2)C=CC(C)(C)O3)OC=C1C4=CC=C(O)C=C4

Synonyms:

• 2H,6H-Benzo[1,2-b:5,4-b′]dipyran-6-one, 7-(4-hydroxyphenyl)-2,2-dimethyl-
• Erythrinin A

Erythrinin A

CAS: 63807-86-3

Erythrinin A is an alkaloid compound, which is an isolated bioactive substance derived from the Erythrina plant species. This compound is primarily sourced from the beans and bark of Erythrina plants, which are native to tropical and subtropical regions. Erythrinin A exhibits its mode of action by interacting with neurotransmitter systems within the central nervous system, possessing properties that may influence receptors such as GABA and others related to neuromodulation.

Formula: C₂₀H₁₆O₄

Purity: Min. 95%

Molecular weight: 320.34 g/mol

Ref: 3D-XE161740