CAS 63810-80-0

2,3-Dichloro-6,7-dimethylquinoxaline

Description:

2,3-Dichloro-6,7-dimethylquinoxaline is a synthetic organic compound belonging to the quinoxaline family, characterized by its bicyclic structure containing two nitrogen atoms in the aromatic rings. This compound typically appears as a solid and is known for its pale yellow to brownish color. It is relatively stable under standard conditions but may undergo reactions typical of halogenated compounds, such as nucleophilic substitution. The presence of chlorine atoms at the 2 and 3 positions, along with methyl groups at the 6 and 7 positions, contributes to its unique chemical reactivity and potential biological activity. 2,3-Dichloro-6,7-dimethylquinoxaline has been studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its solubility can vary depending on the solvent, and it may exhibit moderate toxicity, necessitating careful handling in laboratory settings. As with many quinoxaline derivatives, it may also display interesting properties such as fluorescence or photochemical activity, making it a subject of interest in various fields of research.

Formula: C₁₀H₈Cl₂N₂

InChI: InChI=1/C10H8Cl2N2/c1-5-3-7-8(4-6(5)2)14-10(12)9(11)13-7/h3-4H,1-2H3

SMILES: Cc1cc2c(cc1C)nc(c(Cl)n2)Cl

2,3-Dichloro-6,7-dimethylquinoxaline

CAS: 63810-80-0

Formula: C₁₀H₈Cl₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 227.0899

Ref: IN-DA00E9ES

2,3-Dichloro-6,7-dimethylquinoxaline

CAS: 63810-80-0

2,3-Dichloro-6,7-dimethylquinoxaline

Formula: C₁₀H₈Cl₂N₂

Purity: ≥95%

Color and Shape: white crystalline powder

Molecular weight: 227.09g/mol

Ref: 54-OR11152

2,3-Dichloro-6,7-dimethylquinoxaline

CAS: 63810-80-0

Formula: C₁₀H₈Cl₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 227.09

Ref: 10-F224247