CAS 638140-68-8

N-(5-bromo-6-methylpyridin-2-yl)propanamide

Description:

N-(5-bromo-6-methylpyridin-2-yl)propanamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a methyl group. The presence of the propanamide functional group indicates that it contains a carbonyl group (C=O) bonded to a nitrogen atom (N), which is further connected to a propyl chain. This compound is likely to exhibit polar characteristics due to the amide functional group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The bromine substitution on the pyridine ring may impart specific electronic properties, potentially affecting its reactivity and interactions with biological targets. Additionally, the methyl group can influence steric hindrance and overall molecular conformation. Such compounds are often of interest in medicinal chemistry and drug development due to their potential biological activity. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can be hazardous.

Formula: C₉H₁₁BrN₂O

InChI: InChI=1/C9H11BrN2O/c1-3-9(13)12-8-5-4-7(10)6(2)11-8/h4-5H,3H2,1-2H3,(H,11,12,13)

SMILES: CCC(=Nc1ccc(c(C)n1)Br)O

Synonyms:

• propanamide, N-(5-bromo-6-methyl-2-pyridinyl)-

N-(5-bromo-6-methyl-2-pyridinyl)propanamide

CAS: 638140-68-8

Formula: C₉H₁₁BrN₂O

Purity: 95.0%

Molecular weight: 243.104

Ref: 10-F315508