CAS 6382-01-0
:L-Glutamic acid monopotassium salt monohydrate
Description:
L-Glutamic acid monopotassium salt monohydrate, with the CAS number 6382-01-0, is a potassium salt of the amino acid L-glutamic acid. This compound typically appears as a white crystalline powder and is highly soluble in water, making it useful in various applications, particularly in the food and pharmaceutical industries. It serves as a flavor enhancer, often utilized in savory foods due to its umami taste. The monohydrate form indicates that each molecule of the salt is associated with one molecule of water, which can influence its stability and solubility. L-Glutamic acid itself is a non-essential amino acid that plays a crucial role in cellular metabolism and neurotransmission. The potassium salt form can also contribute to dietary potassium intake, which is important for maintaining proper physiological functions, including nerve transmission and muscle contraction. Overall, L-Glutamic acid monopotassium salt monohydrate is valued for its functional properties and its role in enhancing flavor profiles in various products.
Formula:C5H10KNO5
InChI:InChI=1/C5H9NO4.K.H2O/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);;1H2/q;+1;/p-1/t3-;;/m0../s1
Synonyms:- Ccris 4213
- Glutamic acid, monopotassium salt, monohydrate
- Glutamic acid, monopotassium salt, monohydrate, L-
- Monopotassium L-glutamate monohydrate
- Monopotassium glutamate monohydrate
- potassium 5-oxido-5-oxo-L-norvaline hydrate (1:1:1)
- L-Glutamic acid, monopotassium salt, monohydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
L-Glutamic acid monopotassium salt monohydrate, 97+%
CAS:<p>L-Glutamic acid monopotassium salt monohydrate acts as a common excitatory neurotransmitter like the agonist at kainate, N-methyl-D-aspartate receptor (NMDA) and quisqualate receptors in central nervous system. It is also used in cell culture as a component of MEM non-essential amino acids solution.</p>Formula:C5H10KNO5Purity:97+%Color and Shape:White, Crystals or powder or crystalline powder or granulesMolecular weight:203.24L-GLUTAMIC ACID MONOPOTASSIUM SALT
CAS:Formula:C5H10KNO5Purity:97%Color and Shape:SolidMolecular weight:203.2349L-Glutamic acid monopotassium salt monohydrate
CAS:L-Glutamic acid monopotassium salt monohydratePurity:≥95%Molecular weight:203.234g/molL-Glutamic acid potassium salt monohydrate
CAS:Formula:C5H8KNO4·H2OPurity:≥ 98.5%Color and Shape:White powderMolecular weight:203.25L-Glutamic acid monopotassium salt monohydrate
CAS:<p>Amino acid; neurotransmitter; flavor enhancer</p>Formula:C5H8KNO4·H2OColor and Shape:White PowderMolecular weight:203.23 g/molL-Glutamic acid monopotassium monohydrate
CAS:<p>Please enquire for more information about L-Glutamic acid monopotassium monohydrate including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C5H8KNO4·H2OMolecular weight:203.23 g/molL-Glutamic Acid Monopotassium Salt Monohydrate
CAS:Formula:C5H8KNO4H2OMolecular weight:185.22 : 18.01







