CAS 638217-08-0
:6-Hydroxy-N,2-dimethylbenzofuran-3-carboxamide
Description:
6-Hydroxy-N,2-dimethylbenzofuran-3-carboxamide, identified by its CAS number 638217-08-0, is a chemical compound that belongs to the class of benzofuran derivatives. This substance features a benzofuran core, which is characterized by a fused benzene and furan ring structure, contributing to its unique chemical properties. The presence of a hydroxyl group at the 6-position and a dimethyl group at the 2-position enhances its solubility and reactivity. The carboxamide functional group at the 3-position is significant for its potential biological activity, as it can participate in hydrogen bonding and influence the compound's interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in areas related to neuropharmacology or anti-inflammatory research. However, specific biological activity and safety profiles would require further investigation through empirical studies.
Formula:C11H11NO3
InChI:InChI=1/C11H11NO3/c1-6-10(11(14)12-2)8-4-3-7(13)5-9(8)15-6/h3-5,13H,1-2H3,(H,12,14)
SMILES:Cc1c(c2ccc(cc2o1)O)C(=NC)O
Synonyms:- 6-Hydroxy-N-methyl-2-methyl-1-benzofuran-3-carboxamide
- 6-hydroxy-N,2-dimethyl-1-benzofuran-3-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-Hydroxy-N,2-dimethylbenzofuran-3-carboxamide
CAS:Formula:C11H11NO3Purity:98%Color and Shape:SolidMolecular weight:205.20996-Hydroxy-N,2-dimethylbenzofuran-3-carboxamide
CAS:6-Hydroxy-N,2-dimethylbenzofuran-3-carboxamidePurity:98%Molecular weight:205.21g/mol6-Hydroxy-N,2-dimethylbenzofuran-3-carboxamide
CAS:6-Hydroxy-N,2-dimethylbenzofuran-3-carboxamide is a fine chemical which is used as a building block in the synthesis of complex compounds. It can be used as a reactant in various reactions, such as Friedel-Crafts reactions and cycloadditions. This compound has been shown to be a useful intermediate for the synthesis of various heterocyclic compounds and scaffolds for drug development. 6-Hydroxy-N,2-dimethylbenzofuran-3-carboxamide has CAS number 638217-08-0 and is readily available in high quality.Formula:C11H11NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:205.21 g/mol6-Hydroxy-N,2-dimethylbenzofuran-3-carboxamide
CAS:Controlled ProductFormula:C11H11NO3Color and Shape:NeatMolecular weight:205.21





