CAS 6384-18-5
:1,4-Dimethyl L-aspartate
Description:
1,4-Dimethyl L-aspartate is an amino acid derivative characterized by the presence of two methyl groups attached to the nitrogen atoms of the aspartate backbone. Its molecular structure features a carboxylic acid group, an amino group, and two methyl substituents, which influence its chemical properties and biological activity. This compound is typically a white crystalline solid and is soluble in water due to the polar nature of its functional groups. It is often used in biochemical research and may serve as a building block in the synthesis of various pharmaceuticals or as a neurotransmitter analog. The presence of the methyl groups can enhance its lipophilicity and alter its interaction with biological receptors. Additionally, 1,4-Dimethyl L-aspartate may exhibit specific pharmacological effects, making it of interest in studies related to neurobiology and metabolic pathways. As with many amino acid derivatives, its stability and reactivity can be influenced by pH and temperature, which are important considerations in experimental applications.
Formula:C6H11NO4
InChI:InChI=1S/C6H11NO4/c1-10-5(8)3-4(7)6(9)11-2/h4H,3,7H2,1-2H3/t4-/m0/s1
InChI key:InChIKey=BYHXBBOSJKPUJL-BYPYZUCNSA-N
SMILES:[C@H](CC(OC)=O)(C(OC)=O)N
Synonyms:- L-Aspartic acid, 1,4-dimethyl ester
- Aspartic acid, dimethyl ester, L-
- Dimethyl aspartate
- L-Aspartic acid, dimethyl ester
- 1,4-Dimethyl L-aspartate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dimethyl L-aspartate-13C4-15N
CAS:Controlled ProductFormula:C4C2H1115NO4Color and Shape:NeatMolecular weight:166.12
