CymitQuimica logo

CAS 63843-46-9

:

4-(m-Tolyloxy)piperidine

Description:
4-(m-Tolyloxy)piperidine, identified by its CAS number 63843-46-9, is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of the m-tolyloxy group indicates that a tolyl group, specifically a methyl-substituted phenyl group, is attached to the piperidine at the fourth position. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic tolyl moiety. It may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's structure allows for potential interactions with various biological targets, which could lead to applications in drug development. As with many piperidine derivatives, it may also possess properties such as analgesic or psychoactive effects, depending on its specific interactions within biological systems. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H17NO
InChI:InChI=1/C12H17NO/c1-10-3-2-4-12(9-10)14-11-5-7-13-8-6-11/h2-4,9,11,13H,5-8H2,1H3
InChI key:RTSXWJCYCFVWBU-UHFFFAOYSA-N
SMILES:Cc1cccc(c1)OC1CCNCC1
Synonyms:
  • Piperidine, 4-(3-Methylphenoxy)-
  • 4-(3-Methylphenoxy)Piperidine
Found 5 products.