CAS 63857-17-0
:methyl 3-oxopropanoate
Description:
Methyl 3-oxopropanoate, with the CAS number 63857-17-0, is an organic compound characterized by its ester functional group and a ketone moiety. It typically appears as a colorless to pale yellow liquid with a fruity odor. The molecular structure consists of a propanoate backbone with a ketone group at the 3-position, contributing to its reactivity and potential applications in organic synthesis. This compound is soluble in organic solvents such as ethanol and ether, but it has limited solubility in water due to its hydrophobic characteristics. Methyl 3-oxopropanoate is often used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, as well as in the production of flavoring agents. Its reactivity allows it to participate in various chemical reactions, including condensation and acylation, making it a valuable building block in organic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C4H6O3
InChI:InChI=1/C4H6O3/c1-7-4(6)2-3-5/h3H,2H2,1H3
SMILES:COC(=O)CC=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.