CAS 6386-58-9
:4,4′-Dithiobis[2,6-bis(1,1-dimethylethyl)phenol
Description:
4,4′-Dithiobis[2,6-bis(1,1-dimethylethyl)phenol], with the CAS number 6386-58-9, is an organic compound characterized by its dithiobis structure, which features two phenolic groups linked by a disulfide bond. This compound is known for its antioxidant properties, making it useful in various industrial applications, particularly in the stabilization of polymers and rubber products. The presence of bulky tert-butyl groups on the phenolic rings enhances its steric hindrance, contributing to its stability and effectiveness as a radical scavenger. Additionally, it exhibits good thermal stability, which is advantageous in high-temperature applications. The compound is typically a solid at room temperature and is soluble in organic solvents. Its chemical behavior is influenced by the presence of the disulfide linkage, which can undergo redox reactions, making it relevant in biochemical studies and potential applications in materials science. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C28H42O2S2
InChI:InChI=1S/C28H42O2S2/c1-25(2,3)19-13-17(14-20(23(19)29)26(4,5)6)31-32-18-15-21(27(7,8)9)24(30)22(16-18)28(10,11)12/h13-16,29-30H,1-12H3
InChI key:InChIKey=NEUPRVAMTYHIQV-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=C(O)C(C(C)(C)C)=CC(SSC2=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C2)=C1
Synonyms:- Bis(3,5-di-tert-butyl-4-hydroxyphenyl) disulfide
- 4,4′-Dithiobis[2,6-di-tert-butylphenol]
- 4,4′-Dithiobis[2,6-bis(1,1-dimethylethyl)phenol
- Phenol, 4,4′-dithiobis[2,6-di-tert-butyl-
- Phenol, 4,4′-dithiobis[2,6-bis(1,1-dimethylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Bis(3,5-di-tert-butylphen-4-ol) Disulfide
CAS:Controlled ProductFormula:C28H42O2S2Color and Shape:NeatMolecular weight:474.76


