CAS 63860-31-1
:2-bromo-4-chloro-1-nitrobenzene
Description:
2-Bromo-4-chloro-1-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, a chlorine atom, and a nitro group attached to a benzene ring. Its molecular formula is C6H3BrClN2O2, indicating that it contains six carbon atoms, three hydrogen atoms, one bromine atom, one chlorine atom, two nitrogen atoms, and two oxygen atoms. This compound typically appears as a yellow to brown solid and is known for its moderate solubility in organic solvents like ethanol and dichloromethane, while being less soluble in water. The presence of the nitro group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, the halogen substituents (bromine and chlorine) can influence the compound's electronic properties and reactivity, making it a subject of interest in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated and nitro functionalities.
Formula:C6H3BrClNO2
InChI:InChI=1/C6H3BrClNO2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H
SMILES:c1cc(c(cc1Cl)Br)N(=O)=O
Synonyms:- Benzene, 2-Bromo-4-Chloro-1-Nitro-
- 2-Bromo-4-Chloro-1-Nitro-Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-BROMO-4-CHLORO-1-NITROBENZENE
CAS:Formula:C6H3BrClNO2Purity:96%Color and Shape:SolidMolecular weight:236.45052-Bromo-4-chloro-1-nitrobenzene
CAS:2-Bromo-4-chloro-1-nitrobenzeneFormula:C6H3BrClNO2Purity:97%Color and Shape: bright yellow crystalline needlesMolecular weight:236.45g/mol2-Bromo-4-chloro-1-nitrobenzene
CAS:2-Bromo-4-Chloro-1-Nitro-Benzene is a paraoxon compound that is used to produce chemical weapons. It has been shown to be able to neutralize nerve agent in the body and is undergoing clinical trials as an antidote for nerve agents. 2-Bromo-4-Chloro-1-Nitro-Benzene is produced by trituration from the corresponding bromide or chloride in the presence of nitric acid and hydrochloric acid and can be purified by recrystallization from water. The microreactor process was used to prepare this substance because it gave good yields, was easy to implement, and was cost effective. 2BCNB has also been shown to be a potent transport inhibitor of clozapine with configurable nature, portability, and detoxification properties.Formula:C6H3BrClNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:236.45 g/mol2-Bromo-4-chloronitrobenzene
CAS:Formula:C6H3BrClNO2Purity:95%Color and Shape:Low Melting SolidMolecular weight:236.45



