CAS 6388-72-3
:2-(4-methoxyphenyl)oxirane
Description:
2-(4-Methoxyphenyl)oxirane, also known as a methoxy-substituted epoxide, is an organic compound characterized by its epoxide functional group, which consists of a three-membered cyclic ether. The presence of the 4-methoxyphenyl group contributes to its aromatic properties and influences its reactivity and solubility. This compound typically exhibits a relatively low boiling point and moderate stability under standard conditions, but it can be reactive due to the strained epoxide ring, making it susceptible to nucleophilic attack. The methoxy group enhances its electron-donating properties, which can affect its chemical behavior in various reactions, such as ring-opening reactions with nucleophiles. Additionally, 2-(4-methoxyphenyl)oxirane may have applications in organic synthesis and materials science, particularly in the development of polymers or as intermediates in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as epoxides can be irritants and may pose health risks.
Formula:C9H10O2
InChI:InChI=1/C9H10O2/c1-10-8-4-2-7(3-5-8)9-6-11-9/h2-5,9H,6H2,1H3
SMILES:COc1ccc(cc1)C1CO1
Synonyms:- (4-Methoxyphenyl)oxirane
- Oxirane, (4-methoxyphenyl)-
- 2-(4-Methoxy-phenyl)-oxirane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
