CymitQuimica logo

CAS 63881-17-4

:

3-Amino-5-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]benzoic acid

Description:
3-Amino-5-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]benzoic acid, with CAS number 63881-17-4, is a chemical compound characterized by its complex structure, which includes an amino group, a benzoic acid moiety, and a methoxyethoxy side chain. This compound is typically classified as an amino acid derivative due to the presence of both amino and carboxylic acid functional groups. It exhibits properties such as solubility in polar solvents, which is influenced by the ethoxy groups that enhance its hydrophilicity. The presence of multiple functional groups suggests potential for various chemical reactivity, including acylation and amide formation. Additionally, this compound may have applications in pharmaceuticals or biochemistry, particularly in drug design or as a biochemical probe, owing to its ability to interact with biological systems. Its stability and reactivity can be affected by pH and temperature, making it important to consider these factors in practical applications. Overall, this compound represents a versatile structure with potential utility in various chemical and biological contexts.
Formula:C14H20N2O6
InChI:InChI=1S/C14H20N2O6/c1-20-2-3-21-4-5-22-9-13(17)16-12-7-10(14(18)19)6-11(15)8-12/h6-8H,2-5,9,15H2,1H3,(H,16,17)(H,18,19)
InChI key:InChIKey=UODFUTCYUHTTDJ-UHFFFAOYSA-N
SMILES:N(C(COCCOCCOC)=O)C1=CC(C(O)=O)=CC(N)=C1
Synonyms:
  • Benzoic acid, 3-amino-5-[[[2-(2-methoxyethoxy)ethoxy]acetyl]amino]-
  • 3-Amino-5-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]benzoic acid
  • Benzoic acid, 3-amino-5-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.