CAS 63884-38-8

2-methylcyclopropanecarbohydrazide

Description:

2-Methylcyclopropanecarbohydrazide, with the CAS number 63884-38-8, is an organic compound characterized by its hydrazide functional group attached to a cyclopropane ring. This compound features a methyl group substituent on the cyclopropane, which influences its chemical reactivity and physical properties. Typically, hydrazides are known for their ability to form stable complexes with various metal ions and can participate in a range of chemical reactions, including condensation and hydrazone formation. The presence of the cyclopropane structure may impart unique steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. In terms of physical properties, hydrazides generally exhibit moderate solubility in polar solvents due to their ability to form hydrogen bonds. The compound may also display biological activity, as many hydrazides are investigated for their pharmacological properties. However, specific data regarding its toxicity, stability, and applications may require further research or consultation of specialized literature.

Formula: C₅H₁₀N₂O

InChI: InChI=1/C5H10N2O/c1-3-2-4(3)5(8)7-6/h3-4H,2,6H2,1H3,(H,7,8)

SMILES: CC1CC1C(=NN)O

Synonyms:

• Cyclopropanecarboxylic Acid, 2-Methyl-, Hydrazide
• 2-Methylcyclopropanecarbohydrazide

2-Methylcyclopropane-1-carbohydrazide

CAS: 63884-38-8

2-Methylcyclopropane-1-carbohydrazide

Purity: ≥95%

Molecular weight: 114.15g/mol

Ref: 54-OR111120

2-methylcyclopropane-1-carbohydrazide

CAS: 63884-38-8

Molecular weight: 114.14800262451172

Ref: 10-F518788