CymitQuimica logo

CAS 63886-94-2

:

N-[cyclohexyl(dimethylamino)methyl]benzamide

Description:
N-[Cyclohexyl(dimethylamino)methyl]benzamide is an organic compound characterized by its amide functional group, which is formed from the reaction of a carboxylic acid and an amine. This compound features a benzamide structure, where a benzene ring is attached to an amide group, and it includes a cyclohexyl group and a dimethylamino group, contributing to its unique properties. The presence of the cyclohexyl moiety imparts hydrophobic characteristics, while the dimethylamino group introduces basicity and potential for hydrogen bonding. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic components. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where it may interact with biological targets through various mechanisms. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents on the benzamide core. Overall, N-[cyclohexyl(dimethylamino)methyl]benzamide presents a diverse range of chemical characteristics suitable for further exploration in research and application.
Formula:C16H24N2O
InChI:InChI=1/C16H24N2O/c1-18(2)15(13-9-5-3-6-10-13)17-16(19)14-11-7-4-8-12-14/h4,7-8,11-13,15H,3,5-6,9-10H2,1-2H3,(H,17,19)
SMILES:CN(C)C(C1CCCCC1)N=C(c1ccccc1)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • AH 7563

    CAS:
    <p>AH 7563 is structurally classified as an opioid compound with analgesic properties. In mice, its ED50 for pain relief was 15.3 mg/kg when administered orally in the Phenylquinone test, and 15.5 mg/kg when injected subcutaneously in the Hot plate test.</p>
    Formula:C16H24N2O
    Color and Shape:Solid
    Molecular weight:260.38