CAS 639-43-0
:Akuammicine
Description:
Akuammicine is an indole alkaloid primarily derived from the seeds of the plant Voacanga africana, which is known for its traditional medicinal uses. It is characterized by its complex structure, featuring a bicyclic framework that includes a nitrogen atom in its indole ring. Akuammicine exhibits a range of biological activities, including analgesic, anti-inflammatory, and potential antimalarial effects, making it of interest in pharmacological research. The compound interacts with various neurotransmitter systems, particularly those involving opioid receptors, which may contribute to its analgesic properties. Additionally, it has been studied for its potential effects on the central nervous system. As with many alkaloids, the safety profile and therapeutic potential of akuammicine require further investigation to fully understand its efficacy and possible side effects. Its unique chemical properties and biological activities make it a subject of interest in both natural product chemistry and drug development.
Formula:C20H22N2O2
InChI:InChI=1S/C20H22N2O2/c1-3-12-11-22-9-8-20-14-6-4-5-7-15(14)21-18(20)17(19(23)24-2)13(12)10-16(20)22/h3-7,13,16,21H,8-11H2,1-2H3/b12-3-/t13?,16-,20+/m0/s1
InChI key:InChIKey=AGZMFTKKLPHOMT-AUNCDMLPSA-N
SMILES:C(OC)(=O)C1=C2[C@@]3([C@]4([N@@](CC3)C\C(=C\C)\C1(C4)[H])[H])C=5C(N2)=CC=CC5
Synonyms:- Curan-17-oic acid, 2,16,19,20-tetradehydro-, methyl ester, (19E)-
- 3,5-Ethano-3H-pyrrolo[2,3-d]carbazole, curan-17-oic acid deriv.
- Akuammicine
- (-)-Akuammicine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Akuammicine
CAS:<p>Akuammicine, as an indole alkaloid from Catharanthus roseus, can be used in cancer cell eradication.</p>Formula:C20H22N2O2Color and Shape:SolidMolecular weight:322.408
