CAS 639-81-6
:Ergotaminine
Description:
Ergotaminine is a chemical compound derived from ergot alkaloids, primarily known for its use in the treatment of migraine headaches. It is classified as a semi-synthetic derivative of ergotamine, which is obtained from the fungus Claviceps purpurea. The compound exhibits properties that allow it to act as a vasoconstrictor, influencing blood flow and alleviating migraine symptoms. Ergotaminine has a complex structure characterized by multiple rings and functional groups, contributing to its pharmacological activity. It is typically administered in the form of tablets or injections, and its effects can include nausea and other side effects due to its potent action on vascular smooth muscle. The compound's mechanism of action involves agonism at serotonin receptors, particularly the 5-HT1B and 5-HT1D subtypes, which play a crucial role in regulating vascular tone. Due to its potential for toxicity and side effects, its use is generally limited to specific cases under medical supervision. As with all medications, careful consideration of contraindications and interactions is essential when prescribing ergotaminine.
Formula:C33H35N5O5
InChI:InChI=1S/C33H35N5O5/c1-32(35-29(39)21-15-23-22-10-6-11-24-28(22)20(17-34-24)16-25(23)36(2)18-21)31(41)38-26(14-19-8-4-3-5-9-19)30(40)37-13-7-12-27(37)33(38,42)43-32/h3-6,8-11,15,17,21,25-27,34,42H,7,12-14,16,18H2,1-2H3,(H,35,39)/t21-,25+,26-,27-,32+,33-/m0/s1
InChI key:InChIKey=XCGSFFUVFURLIX-BRMNWJGKSA-N
SMILES:O[C@@]12N([C@@H](CC3=CC=CC=C3)C(=O)N4[C@]1(CCC4)[H])C(=O)[C@@](NC(=O)[C@H]5C=C6C=7C=8C(C[C@]6(N(C)C5)[H])=CNC8C=CC7)(C)O2
Synonyms:- (5′α,8α)-12′-Hydroxy-2′-methyl-5′-(phenylmethyl)ergotaman-3′,6′,18-trione
- 12'-Hydroxy-2'-methyl-5'a-(phenylmethyl)-8a-ergotaman-3',6',18-trione
- 639-81-6
- 8H-Oxazolo[3,2-a]pyrrolo[2,1-c]pyrazine, ergotaman-3′,6′,18-trione deriv.
- Ergotaman-3′,6′,18-trione, 12′-hydroxy-2′-methyl-5′-(phenylmethyl)-, (5′α,8α)-
- Ergotaminine
- Indolo[4,3-fg]quinoline, ergotaman-3′,6′,18-trione deriv.
- Isoergotamine
- (5'alpha,8alpha)-5'-Benzyl-12'-hydroxy-2'-methyl-3',6',18-trioxoergotaman
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ergotaminine
CAS:Controlled ProductErgotaminine is a drug used to treat migraine attacks. It belongs to the pharmacological agents and has a basic structure that is similar to ergotamine. Ergotamine is an alkaloid extracted from the fungus Claviceps purpurea, which is used as a drug for the treatment of migraine headaches. Ergotamine also has other pharmacological effects such as vasoconstriction and uterine contraction. Ergotamine can cause side effects such as nausea, vomiting, and diarrhea. One of its main disadvantages is that it can lead to drug interactions with other drugs because it interacts with cytochrome P450 enzymes in the liver by inhibiting them. Ergotamine also has analytical methods such as gas chromatography-mass spectrometry, liquid chromatography-mass spectrometry, and fluorescence detection. Ergotamine can be used for treating infectious diseases such as carcinoid syndrome or angiogenic process caused by nonsteroidal anti-inflammatory drugs (NSAIDsFormula:C33H35N5O5Purity:Min. 95%Color and Shape:PowderMolecular weight:581.7 g/molErgotaminine
CAS:Alkaloids of rye ergot and their derivatives; salts thereof, nesoiFormula:C33H35N5O5Color and Shape:White Off-White Light Grey Crystalline PowderMolecular weight:581.26382




