CAS 639054-51-6

(2R)-2-Amino-2-(4-methylphenyl)ethanol

Description:

(2R)-2-Amino-2-(4-methylphenyl)ethanol, also known as a chiral amino alcohol, is characterized by its specific stereochemistry, which plays a crucial role in its biological activity and interactions. This compound features an amino group (-NH2) and a hydroxyl group (-OH) attached to a carbon atom that is also bonded to a 4-methylphenyl group, contributing to its hydrophobic characteristics. The presence of the chiral center at the second carbon atom imparts optical activity, making it important in pharmaceutical applications where enantiomeric purity can influence efficacy and safety. The compound is typically a white to off-white solid and is soluble in polar solvents due to the hydroxyl group, while the aromatic ring enhances its lipophilicity. Its potential applications may include use in the synthesis of pharmaceuticals, particularly in the development of drugs targeting the central nervous system or other biological pathways. As with many amino alcohols, it may also exhibit properties such as acting as a chiral auxiliary in asymmetric synthesis.

Formula: C₉H₁₃NO

InChI: InChI=1S/C9H13NO/c1-7-2-4-8(5-3-7)9(10)6-11/h2-5,9,11H,6,10H2,1H3/t9-/m0/s1

SMILES: Cc1ccc(cc1)[C@H](CO)N

(R)-b-Amino-4-methyl-benzeneethanol

CAS: 639054-51-6

Formula: C₉H₁₃NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 151.2056

Ref: IN-DA00ELJ5

(R)-b-Amino-4-methyl-benzeneethanol

CAS: 639054-51-6

(R)-b-Amino-4-methyl-benzeneethanol

Purity: 95%

Molecular weight: 151.21g/mol

Ref: 54-OR452141

(2R)-2-AMINO-2-(4-METHYLPHENYL)ETHAN-1-OL

CAS: 639054-51-6

Formula: C₉H₁₃NO

Purity: 98%

Molecular weight: 151.209

Ref: 10-F514290