CAS 63906-79-6
:2-(2-hydroxyethoxy)benzamide
Description:
2-(2-Hydroxyethoxy)benzamide, with the CAS number 63906-79-6, is an organic compound characterized by its benzamide structure, which features a benzene ring attached to an amide functional group. The presence of a hydroxyethoxy group enhances its solubility in polar solvents and contributes to its potential as a bioactive molecule. This compound typically exhibits moderate to high polarity due to the hydroxyl group, which can engage in hydrogen bonding, influencing its reactivity and interaction with biological systems. It may also display properties such as moderate thermal stability and a specific melting point range, depending on its purity and crystalline form. The compound's functional groups suggest potential applications in pharmaceuticals, particularly in drug design, where modifications to the benzamide structure can lead to enhanced biological activity. Additionally, its chemical stability and solubility characteristics make it a candidate for various chemical synthesis processes. Overall, 2-(2-hydroxyethoxy)benzamide is a versatile compound with potential utility in both research and industrial applications.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c10-9(12)7-3-1-2-4-8(7)13-6-5-11/h1-4,11H,5-6H2,(H2,10,12)
SMILES:c1ccc(c(c1)C(=N)O)OCCO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-(2-Hydroxyethoxy)benzamide
CAS:<p>2-(2-Hydroxyethoxy)benzamide is a dopamine receptor agonist that inhibits 5-HT3 receptors in vitro. It is an orally active drug that has been shown to have a good safety profile in humans. 2-(2-Hydroxyethoxy)benzamide has also been shown to be a 5-HT4 receptor antagonist, which may account for the lack of serotonin syndrome in animal studies. This drug can cause intestinal contractions and nausea, and may also cause symptoms such as headache, dizziness, and insomnia. Levosulpiride is a selective 5-HT4 receptor agonist that may be more effective than 2-(2-Hydroxyethoxy)benzamide at alleviating the gastrointestinal side effects of this drug.</p>Formula:C9H11NO3Purity:Min. 95%Molecular weight:181.19 g/mol
