CAS 63907-06-2
:N,3,3-trimethylbicyclo[2.2.1]heptan-2-amine
Description:
N,3,3-trimethylbicyclo[2.2.1]heptan-2-amine, with the CAS number 63907-06-2, is a bicyclic amine characterized by its unique structure, which features a bicyclo[2.2.1]heptane framework with three methyl groups attached to the nitrogen atom at the 3-position. This compound exhibits properties typical of amines, including basicity due to the presence of the nitrogen atom, which can accept protons. The steric hindrance introduced by the three methyl groups can influence its reactivity and interaction with other molecules. Additionally, the bicyclic structure contributes to its rigidity, potentially affecting its conformational flexibility and overall chemical behavior. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications in drug development or as a building block for more complex molecules. Its specific physical properties, such as boiling point, melting point, and solubility, would need to be determined experimentally, as they can vary based on environmental conditions and purity.
Formula:C10H19N
InChI:InChI=1/C10H19N/c1-10(2)8-5-4-7(6-8)9(10)11-3/h7-9,11H,4-6H2,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Norbornanamine, N,3,3-trimethyl-
CAS:2-Norbornanamine, N,3,3-trimethyl- is a Drug / Therapeutic Agent.Formula:C10H19NColor and Shape:SolidMolecular weight:153.26
