CymitQuimica logo

CAS 63907-29-9

:

4H-imidazo[4,5-d][1,2,3]triazin-4-one

Description:
4H-imidazo[4,5-d][1,2,3]triazin-4-one is a heterocyclic compound characterized by its fused imidazole and triazine rings, which contribute to its unique chemical properties. This compound typically exhibits a planar structure, allowing for potential π-π stacking interactions, which can influence its solubility and reactivity. It contains nitrogen atoms in its ring structure, which can participate in hydrogen bonding and coordination with metal ions, making it of interest in coordination chemistry and materials science. The presence of the carbonyl group (C=O) at the 4-position enhances its reactivity, potentially allowing for further functionalization. This compound may also exhibit biological activity, making it a candidate for pharmaceutical applications. Its stability and solubility in various solvents can vary, depending on the specific conditions and substituents present. Overall, 4H-imidazo[4,5-d][1,2,3]triazin-4-one is a versatile compound with potential applications in medicinal chemistry and materials development.
Formula:C4HN5O
InChI:InChI=1/C4HN5O/c10-4-2-3(6-1-5-2)7-9-8-4/h1H
SMILES:C1=NC2=NN=NC(=O)C2=N1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.