CAS 63910-32-7

3,4-dichloro-5-methoxypyridazine

Description:

3,4-Dichloro-5-methoxypyridazine is a heterocyclic organic compound characterized by a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of two chlorine atoms at the 3 and 4 positions and a methoxy group at the 5 position contributes to its unique chemical properties. This compound typically exhibits moderate to high stability due to the aromatic nature of the pyridazine ring, and its chlorinated structure may enhance its reactivity in certain chemical reactions, such as nucleophilic substitutions. The methoxy group can influence the compound's solubility and polarity, making it more soluble in organic solvents. 3,4-Dichloro-5-methoxypyridazine may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and reactivity. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.

Formula: C₅H₄Cl₂N₂O

InChI: InChI=1/C5H4Cl2N2O/c1-10-3-2-8-9-5(7)4(3)6/h2H,1H3

SMILES: COc1cnnc(c1Cl)Cl

3,4-Dichloro-5-methoxypyridazine

CAS: 63910-32-7

Formula: C₅H₄Cl₂N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.0041

Ref: IN-DA00EJZW

3,4-Dichloro-5-methoxy-pyridazine

CAS: 63910-32-7

3,4-Dichloro-5-methoxy-pyridazine

Purity: 98%

Molecular weight: 179.00g/mol

Ref: 54-OR79146

3,4-Dichloro-5-methoxy-pyridazine

CAS: 63910-32-7

Purity: 98%

Molecular weight: 179

Ref: 10-F624887

3,4-Dichloro-5-methoxypyridazine

CAS: 63910-32-7

Versatile small molecule scaffold

Formula: C₅H₄Cl₂N₂O

Purity: Min. 95%

Molecular weight: 179.01 g/mol

Ref: 3D-NCA91032