CAS 63916-09-6

3-[(6-amino-4-oxo-1,4-dihydropyrimidin-2-yl)sulfanyl]propanoic acid

Description:

3-[(6-amino-4-oxo-1,4-dihydropyrimidin-2-yl)sulfanyl]propanoic acid, identified by its CAS number 63916-09-6, is a chemical compound that features a dihydropyrimidine core, which is a bicyclic structure known for its presence in various biologically active molecules. This compound contains a sulfanyl group, indicating the presence of a sulfur atom bonded to a carbon chain, which contributes to its reactivity and potential biological activity. The propanoic acid moiety suggests that it has carboxylic acid functionality, which can participate in acid-base reactions and may influence its solubility and interaction with biological systems. The amino group attached to the pyrimidine ring enhances its potential for hydrogen bonding and may play a role in its pharmacological properties. Overall, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in areas such as antimicrobial or anticancer research, although specific biological activities would require further investigation.

Formula: C₇H₉N₃O₃S

InChI: InChI=1/C7H9N3O3S/c8-4-3-5(11)10-7(9-4)14-2-1-6(12)13/h3H,1-2H2,(H,12,13)(H3,8,9,10,11)

SMILES: C(CSc1nc(cc(n1)O)N)C(=O)O

Synonyms:

• Propanoic Acid, 3-[(6-Amino-1,4-Dihydro-4-Oxo-2-Pyrimidinyl)Thio]-

3-[(4-amino-6-oxo-1,6-dihydropyrimidin-2-yl)thio]propanoic acid

CAS: 63916-09-6

Formula: C₇H₉N₃O₃S

Purity: 95.0%

Molecular weight: 215.23

Ref: 10-F315224