CymitQuimica logo

CAS 6392-45-6

:

3,5-dimethyl-4-(methylamino)phenol

Description:
3,5-Dimethyl-4-(methylamino)phenol, with the CAS number 6392-45-6, is an organic compound characterized by its aromatic structure, which includes a phenolic group. This compound features two methyl groups located at the 3 and 5 positions of the phenol ring, and a methylamino group at the 4 position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit solubility in organic solvents due to its hydrophobic methyl groups, while the phenolic hydroxyl group can engage in hydrogen bonding, enhancing its solubility in polar solvents. The presence of the methylamino group suggests potential basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. This compound is often used in dye chemistry and as an intermediate in the synthesis of other organic compounds. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 3,5-dimethyl-4-(methylamino)phenol is a versatile compound with applications in various chemical industries.
Formula:C9H13NO
InChI:InChI=1/C9H13NO/c1-6-4-8(11)5-7(2)9(6)10-3/h4-5,10-11H,1-3H3
SMILES:Cc1cc(cc(C)c1NC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.