
CAS 6392-47-8
:2,6-Bis(1,1-dimethylethyl)-4-(hydrazinylmethyl)phenol
Description:
2,6-Bis(1,1-dimethylethyl)-4-(hydrazinylmethyl)phenol, commonly referred to by its CAS number 6392-47-8, is an organic compound characterized by its phenolic structure, which features two bulky tert-butyl groups and a hydrazinylmethyl substituent. This compound exhibits properties typical of phenols, including potential antioxidant activity due to the presence of the hydroxyl group. The tert-butyl groups contribute to its steric bulk, which can influence its reactivity and solubility in various solvents. The hydrazinylmethyl group may impart specific biological activities, making it of interest in medicinal chemistry and materials science. Additionally, the compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which could affect its physical properties such as melting point and boiling point. Overall, 2,6-Bis(1,1-dimethylethyl)-4-(hydrazinylmethyl)phenol is a compound of interest for its potential applications in various fields, including pharmaceuticals and polymer chemistry.
Formula:C15H26N2O
InChI:InChI=1S/C15H26N2O/c1-14(2,3)11-7-10(9-17-16)8-12(13(11)18)15(4,5)6/h7-8,17-18H,9,16H2,1-6H3
InChI key:InChIKey=IASJHJLPUUPIDH-UHFFFAOYSA-N
SMILES:OC1=C(C(C)(C)C)C=C(CNN)C=C1C(C)(C)C
Synonyms:- 2,6-Bis(1,1-dimethylethyl)-4-(hydrazinylmethyl)phenol
- Phenol, 2,6-bis(1,1-dimethylethyl)-4-(hydrazinylmethyl)-
- p-Cresol, 2,6-di-tert-butyl-α-hydrazino-
- 2,6-Di-tert-butyl-4-(hydrazinylmethyl)phenol
- Phenol, 2,6-bis(1,1-dimethylethyl)-4-(hydrazinomethyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery