CymitQuimica logo

CAS 63920-73-0

:

Benzamide, 2-amino-4,6-dimethoxy-

Description:
Benzamide, 2-amino-4,6-dimethoxy- is an organic compound characterized by its amide functional group attached to a benzene ring, which is further substituted with amino and methoxy groups. The presence of the amino group (-NH2) indicates potential basic properties, while the methoxy groups (-OCH3) contribute to its overall polarity and influence its solubility in various solvents. This compound typically exhibits moderate stability under standard conditions but may undergo hydrolysis in the presence of strong acids or bases. Its molecular structure suggests potential applications in pharmaceuticals, particularly as a building block in drug synthesis or as a research chemical. The methoxy substituents can also affect the compound's electronic properties, potentially enhancing its reactivity or interaction with biological targets. Additionally, the compound's unique arrangement of functional groups may impart specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C9H12N2O3
InChI:InChI=1S/C9H12N2O3/c1-13-5-3-6(10)8(9(11)12)7(4-5)14-2/h3-4H,10H2,1-2H3,(H2,11,12)
InChI key:LSDUYZHWQMMNCO-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C(=C1)OC)C(=O)N)N
Synonyms:
  • 2-Amino-4,6-Dimethoxybenzamide
Found 4 products.