CAS 63927-95-7
:Bentemazole
Description:
Bentemazole, identified by its CAS number 63927-95-7, is a chemical compound that belongs to the class of benzimidazole derivatives. It is primarily recognized for its application in the field of veterinary medicine, particularly as an anthelmintic agent, which means it is used to treat parasitic worm infections in animals. The compound exhibits a broad spectrum of activity against various helminths, making it valuable in managing parasitic diseases. Bentemazole's mechanism of action typically involves disrupting the energy metabolism of the parasites, leading to their eventual death. In terms of physical properties, it is generally characterized by its solubility in organic solvents and limited solubility in water, which is common for many benzimidazole derivatives. Safety and handling precautions are essential when working with this compound, as with any chemical substance, to mitigate potential health risks. Overall, Bentemazole plays a significant role in veterinary pharmacology, contributing to the health and well-being of livestock and pets.
Formula:C11H10N6
InChI:InChI=1/C11H10N6/c1-2-4-9(5-3-1)8-17-7-6-12-11(17)10-13-15-16-14-10/h1-7H,8H2,(H,13,14,15,16)
Synonyms:- 5-(1-Benzyl-1H-imidazol-2-yl)-1H-tetrazole
- 63927-95-7
- 1H-tetrazole, 5-[1-(phenylmethyl)-1H-imidazol-2-yl]-
- 5-(1-benzyl-1H-imidazol-2-yl)-2H-tetrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-(1-Benzyl-1H-imidazol-2-yl)-1H-1,2,3,4-tetrazole
CAS:<p>5-(1-Benzyl-1H-imidazol-2-yl)-1H-1,2,3,4-tetrazole is a diagnostic agent that can be used for iontophoresis. It is insoluble in water and therefore cannot be administered by injection. 5-(1-Benzyl-1H-imidazol-2-yl)-1H-1,2,3,4-tetrazole is reconstituted with an antisolvent or diluent before use as an iontophoretic drug. It is hydrophobic and binds to the skin surface during iontophoresis, allowing for the passage of ions through the skin.</p>Formula:C11H10N6Purity:Min. 95%Molecular weight:226.24 g/mol
