CAS 63932-26-3

1-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine

Description:

1-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine, with the CAS number 63932-26-3, is a chemical compound characterized by its unique thieno[3,2-c]pyran structure, which incorporates a fused thiophene and pyran ring system. This compound features a methanamine functional group, contributing to its potential reactivity and biological activity. The thieno[3,2-c]pyran moiety is known for its involvement in various pharmacological activities, making this compound of interest in medicinal chemistry. It typically exhibits moderate to high solubility in polar solvents, and its molecular structure suggests potential interactions with biological targets, which may lead to applications in drug development. The presence of the amine group may also facilitate hydrogen bonding, influencing its behavior in biological systems. Overall, this compound's unique structural features and functional groups position it as a candidate for further research in the fields of organic synthesis and pharmacology.

Formula: C₈H₁₁NOS

InChI: InChI=1/C8H11NOS/c9-5-7-6-2-4-11-8(6)1-3-10-7/h2,4,7H,1,3,5,9H2

SMILES: C1COC(CN)c2ccsc12

Synonyms:

• (6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methylamine

1-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-yl)methylamine

CAS: 63932-26-3

1-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-yl)methylamine

Purity: 97%

Molecular weight: 169.24g/mol

Ref: 54-OR8696