CAS 63950-05-0

3-(1,2-dihydroxyethyl)-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxyhexopyranoside

Description:

The chemical substance known as "3-(1,2-dihydroxyethyl)-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxyhexopyranoside," with the CAS number 63950-05-0, is a complex organic compound characterized by its intricate molecular structure. It features multiple hydroxyl groups, indicating significant hydrophilicity, which may influence its solubility and reactivity in biological systems. The presence of a methoxy group suggests potential for methylation reactions, while the dioxo functionality indicates the presence of carbonyl groups, which can participate in various chemical reactions, including nucleophilic attacks. The hexahydrotetracene backbone contributes to its stability and potential aromatic characteristics, while the amino and deoxyhexopyranoside components suggest biological relevance, possibly as a glycoside. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and biochemistry. Its complex structure and functional groups could lead to diverse interactions in biological systems, warranting investigation into its potential applications.

Formula: C₂₇H₃₁NO₁₁

InChI: InChI=1/C27H31NO11/c1-10-22(31)13(28)6-17(38-10)39-15-8-27(36,16(30)9-29)7-12-19(15)26(35)21-20(24(12)33)23(32)11-4-3-5-14(37-2)18(11)25(21)34/h3-5,10,13,15-17,22,29-31,33,35-36H,6-9,28H2,1-2H3

SMILES: CC1C(C(CC(O1)OC1CC(Cc2c1c(c1c(C(=O)c3cccc(c3C1=O)OC)c2O)O)(C(CO)O)O)N)O

Doxorubicinol hydrochloride

CAS: 63950-05-0

Doxorubicinol hydrochloride, also known as 13-Dihydroadriamycin hydrochloride, is a secondary alcohol metabolite derived from Doxorubicin.

Formula: C₂₇H₃₂ClNO₁₁

Color and Shape: Solid

Molecular weight: 582.0

Ref: TM-T40736

Doxorubicinol HCl

CAS: 63950-05-0

Formula: C₂₇H₃₁NO₁₁·HCl

Molecular weight: 545.54 36.46

Ref: 4Z-D-3491

Doxorubicinol Hydrochloride (>90%)(Mixture of diastereomers)

Controlled Product

CAS: 54193-28-1, 63950-05-0

Applications A metabolite of Doxorubicin as neoplasm inhibitor.
References Smith, T.H.

Formula: C₂₇H₃₁NO₁₁•HCl

Color and Shape: Red

Molecular weight: 545.54 + 36.46

Ref: TR-D558020

Doxorubicinol hydrochloride - Mixture of Diasteromers

CAS: 63950-05-0

Please enquire for more information about Doxorubicinol hydrochloride - Mixture of Diasteromers including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂₇H₃₂ClNO₁₁

Purity: Min. 95%

Molecular weight: 582 g/mol

Ref: 3D-FD71682