CAS 63954-77-8

3,5-difluoro-2-hydroxybenzaldehyde

Description:

3,5-Difluoro-2-hydroxybenzaldehyde, with the CAS number 63954-77-8, is an organic compound characterized by the presence of both aldehyde and hydroxyl functional groups on a benzene ring that is further substituted with fluorine atoms. This compound features a benzaldehyde structure, where the aldehyde group (-CHO) is located at the second position, while hydroxyl (-OH) and two fluorine atoms are positioned at the 3rd and 5th carbon atoms, respectively. The presence of fluorine atoms enhances the compound's reactivity and can influence its physical properties, such as solubility and boiling point. Typically, compounds like this exhibit polar characteristics due to the hydroxyl group, which can engage in hydrogen bonding. Additionally, the fluorine substituents can impart unique electronic properties, making this compound of interest in various chemical applications, including pharmaceuticals and agrochemicals. Its synthesis and reactivity can be explored in the context of organic synthesis and medicinal chemistry, where such modifications can lead to compounds with enhanced biological activity or specificity.

Formula: C₇H₄F₂O₂

InChI: InChI=1/C7H4F2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H

SMILES: c1c(C=O)c(c(cc1F)F)O

Synonyms:

• 3,5-Difluorosalicylaldehyde

3,5-Difluoro-2-hydroxybenzaldehyde

CAS: 63954-77-8

Formula: C₇H₄F₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 158.1023

Ref: IN-DA003IN9

3,5-Difluoro-2-hydroxybenzaldehyde

CAS: 63954-77-8

3,5-Difluoro-2-hydroxybenzaldehyde

Formula: C₇H₄F₂O₂

Purity: 98%

Color and Shape: white to off-white solid

Molecular weight: 158.10g/mol

Ref: 54-PC1112

3,5-Difluoro-2-hydroxybenzaldehyde

CAS: 63954-77-8

Formula: C₇H₄F₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 158.104

Ref: 10-F234314