CAS 63963-40-6
:2-(methylsulfanyl)quinazolin-4-amine
Description:
2-(Methylsulfanyl)quinazolin-4-amine is a chemical compound characterized by its quinazoline core, which is a bicyclic structure composed of a benzene ring fused to a pyrimidine ring. This compound features a methylsulfanyl group (-S-CH3) attached to the second position of the quinazoline ring and an amino group (-NH2) at the fourth position. The presence of the methylsulfanyl group contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The amino group can participate in hydrogen bonding, influencing the compound's interactions in biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, solubility, and reactivity, can vary based on environmental conditions and the presence of other functional groups. As with many quinazoline derivatives, it may be investigated for its potential therapeutic applications, particularly in the fields of oncology and neurology.
Formula:C9H9N3S
InChI:InChI=1/C9H9N3S/c1-13-9-11-7-5-3-2-4-6(7)8(10)12-9/h2-5H,1H3,(H2,10,11,12)
SMILES:CSc1nc2ccccc2c(=N)[nH]1
Synonyms:- 2-(Methylsulfanyl)-4-Quinazolinamine
- 4-Quinazolinamine, 2-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(Methylthio)quinazolin-4-amine
CAS:Formula:C9H9N3SPurity:%Color and Shape:SolidMolecular weight:191.2529

