CAS 63968-26-3
:ethyl 4-(2-methylphenyl)-3-oxobutanoate
Description:
Ethyl 4-(2-methylphenyl)-3-oxobutanoate, with the CAS number 63968-26-3, is an organic compound characterized by its ester functional group and a ketone moiety. This compound features a butanoate backbone, which is substituted at the fourth position with a 2-methylphenyl group, contributing to its aromatic characteristics. The presence of the ketone group at the third position enhances its reactivity, making it a potential candidate for various chemical reactions, including condensation and acylation. Ethyl 4-(2-methylphenyl)-3-oxobutanoate is typically a colorless to pale yellow liquid, exhibiting moderate solubility in organic solvents. Its molecular structure suggests it may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's unique structure may impart specific biological activities, warranting further investigation into its potential uses in medicinal chemistry. As with many organic compounds, safety data should be consulted to ensure proper handling and usage in laboratory settings.
Formula:C13H16O3
InChI:InChI=1/C13H16O3/c1-3-16-13(15)9-12(14)8-11-7-5-4-6-10(11)2/h4-7H,3,8-9H2,1-2H3
SMILES:CCOC(=O)CC(=O)Cc1ccccc1C
Synonyms:- Benzenebutanoic acid, 2-methyl-β-oxo-, ethyl ester
- Ethyl 4-(2-methylphenyl)-3-oxobutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Oxo-4-o-tolyl-butyric acid ethyl ester
CAS:Formula:C13H16O3Color and Shape:LiquidMolecular weight:220.268
