CAS 63968-85-4
:2-(Trifluoromethoxy)benzonitrile
Description:
2-(Trifluoromethoxy)benzonitrile is an organic compound characterized by the presence of a benzonitrile moiety substituted with a trifluoromethoxy group. Its molecular structure features a benzene ring attached to a cyano group (–C≡N) and a trifluoromethoxy group (–O–CF3), which significantly influences its chemical properties. This compound is typically a colorless to pale yellow solid and is known for its high stability and low volatility. The trifluoromethoxy group enhances its lipophilicity and can impart unique electronic properties, making it useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the presence of the cyano group contributes to its reactivity, allowing for potential transformations in synthetic chemistry. Due to its fluorinated nature, 2-(Trifluoromethoxy)benzonitrile may exhibit distinct solubility characteristics in organic solvents. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks. Overall, this compound is of interest in both research and industrial contexts due to its unique functional groups and properties.
Formula:C8H4F3NO
InChI:InChI=1S/C8H4F3NO/c9-8(10,11)13-7-4-2-1-3-6(7)5-12/h1-4H
InChI key:InChIKey=ACNBBQGAWMHXLA-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(C#N)C=CC=C1
Synonyms:- 2,2,3,3,4,4,4-Heptafluorobutyl Trifluoromethanesulfonate
- Benzonitrile, 2-(trifluoromethoxy)-
- o-Cyanotrifluoromethoxybenzene
- o-Trifluoromethoxybenzonitrile
- 2-(Trifluoromethoxy)benzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(Trifluoromethoxy)benzonitrile
CAS:Formula:C8H4F3NOPurity:>98.0%(GC)Color and Shape:Colorless to Yellow clear liquidMolecular weight:187.122-(Trifluoromethoxy)benzonitrile
CAS:Formula:C8H4F3NOPurity:97%Color and Shape:LiquidMolecular weight:187.11872-(Trifluoromethoxy)benzonitrile
CAS:2-(Trifluoromethoxy)benzonitrileFormula:C8H4F3NOPurity:97%Color and Shape:LiquidMolecular weight:187.12g/molo-(Trifluoromethoxy)benzonitrile
CAS:<p>o-(Trifluoromethoxy)benzonitrile is a fine chemical that is mainly used as a reagent in organic synthesis. It is also used as a building block in the synthesis of various other chemicals, such as pharmaceuticals, dyes, and pesticides. O-(Trifluoromethoxy)benzonitrile is a versatile intermediate that can be used to synthesize a variety of compounds with different functional groups. This compound has been shown to have high quality and can be used for research purposes or as an intermediate for industrial processes.</p>Formula:C8H4F3NOPurity:Min. 95%Molecular weight:187.12 g/mol2-(Trifluoromethoxy)benzonitrile
CAS:Formula:C8H4F3NOPurity:97%Color and Shape:Liquid, Clear colourless to pale yellow liquidMolecular weight:187.121




