CAS 63969-83-5
:methyl (2-formylphenyl)acetate
Description:
Methyl (2-formylphenyl)acetate, with the CAS number 63969-83-5, is an organic compound characterized by its ester functional group. It features a methyl ester derived from the reaction of acetic acid and 2-formylphenol. This compound typically appears as a colorless to pale yellow liquid with a pleasant, sweet aroma, making it potentially useful in flavor and fragrance applications. Its molecular structure includes a phenyl ring substituted with a formyl group and an acetate moiety, contributing to its reactivity and potential applications in organic synthesis. Methyl (2-formylphenyl)acetate is likely to exhibit moderate solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic ring. The compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it a valuable intermediate in the synthesis of more complex organic molecules. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C10H10O3
InChI:InChI=1/C10H10O3/c1-13-10(12)6-8-4-2-3-5-9(8)7-11/h2-5,7H,6H2,1H3
SMILES:COC(=O)Cc1ccccc1C=O
Synonyms:- Benzeneacetic Acid, 2-Formyl-, Methyl Ester
- Methyl (2-formylphenyl)acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2-(2-formylphenyl)acetate
CAS:Methyl 2-(2-formylphenyl)acetateFormula:C10H10O3Purity:95%Molecular weight:178.19Methyl 2-(2-formylphenyl);acetate
CAS:Formula:C10H10O3Purity:95%Color and Shape:LiquidMolecular weight:178.1846Methyl 2-(2-formylphenyl)acetate
CAS:Methyl 2-(2-formylphenyl)acetateFormula:C10H10O3Purity:95%Molecular weight:178.18Methyl 2-(2-formylphenyl)acetate
CAS:Formula:C10H10O3Purity:95%Color and Shape:LiquidMolecular weight:178.187methyl 2-(2-formylphenyl)acetate
CAS:Controlled ProductStability Air Sensitive
Applications methyl 2-(2-formylphenyl)acetate (cas# 63969-83-5) is a useful research chemical.Formula:C10H10O3Color and Shape:NeatMolecular weight:178.18




