CAS 6397-33-7
:2-(propan-2-ylsulfanyl)aniline
Description:
2-(Propan-2-ylsulfanyl)aniline, also known by its CAS number 6397-33-7, is an organic compound characterized by the presence of an aniline group (an amino group attached to a benzene ring) and a propan-2-ylsulfanyl (isopropylthio) substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents but may have limited solubility in water due to the hydrophobic nature of the isopropyl group. The presence of the sulfanyl group imparts unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Safety data should be consulted, as compounds containing sulfur and amine functionalities can pose health risks if not handled properly. Overall, 2-(propan-2-ylsulfanyl)aniline is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C9H13NS
InChI:InChI=1/C9H13NS/c1-7(2)11-9-6-4-3-5-8(9)10/h3-7H,10H2,1-2H3
SMILES:CC(C)Sc1ccccc1N
Synonyms:- 2-(Isopropylthio)Aniline
- 2-(Isopropylsulfanyl)Aniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Isopropylthio)aniline
CAS:2-(Isopropylthio)aniline is a synthetic chemical compound. It is a primary alkyl amine, with the chemical formula CH3CH2NHCH2CH2SCH3. It has two alkyl groups, one substituent and one trifluoroacetic acid group. 2-(Isopropylthio)aniline is synthesized in the laboratory by reacting benzene with an aminophenyl group and an alkyl group. The reaction proceeds via the following steps: 1) Addition of trifluoroacetic acid to benzene 2) Addition of aminophenyl group to benzene 3) Addition of an alkyl group to benzene 4) Reaction of the newly formed 2-chloro-benzoyl chloride with ammonia 5) Reaction of the newly formed 2-aminobenzamide with hydrogen sulfideFormula:C9H13NSPurity:Min. 95%Molecular weight:167.28 g/mol



