CAS 63971-25-5
:3-amino-5,7-dimethyltricyclo[3.3.1.1~3,7~]decan-1-ol
Description:
3-Amino-5,7-dimethyltricyclo[3.3.1.1^3,7]decan-1-ol is a bicyclic organic compound characterized by its complex tricyclic structure, which includes three interconnected rings. The presence of an amino group (-NH2) and a hydroxyl group (-OH) contributes to its potential as a functionalized compound, making it of interest in various chemical applications, including pharmaceuticals and organic synthesis. The dimethyl substitutions at the 5 and 7 positions enhance its steric properties and may influence its reactivity and solubility. This compound's unique structure can lead to interesting stereochemical configurations, which may affect its biological activity. Additionally, the tricyclic framework is often associated with compounds that exhibit significant biological properties, making it a candidate for further research in medicinal chemistry. Its CAS number, 63971-25-5, allows for easy identification and retrieval of information in chemical databases. Overall, 3-amino-5,7-dimethyltricyclo[3.3.1.1^3,7]decan-1-ol represents a fascinating example of complex organic chemistry with potential applications in various fields.
Formula:C12H21NO
InChI:InChI=1/C12H21NO/c1-9-3-10(2)5-11(13,4-9)8-12(14,6-9)7-10/h14H,3-8,13H2,1-2H3
SMILES:CC12CC3(C)CC(C1)(CC(C2)(C3)O)N
Synonyms:- 3-Amino-5,7-Dimethyladamantan-1-Ol
- 3-Amino-5,7-Dimethyladamantan-1-Ol Hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Memantine USP Related Compound F (Free Form)
CAS:Formula:C12H21NOColor and Shape:White To Off-White SolidMolecular weight:195.31

