CAS 63972-18-9

diethyl (3-cyanopropyl)propanedioate

Description:

Diethyl (3-cyanopropyl)propanedioate, with the CAS number 63972-18-9, is an organic compound characterized by its structure, which includes two ethyl ester groups and a propanedioate backbone. This compound features a cyano group (-C≡N) attached to the propyl chain, which contributes to its reactivity and potential applications in organic synthesis. Typically, it appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the cyano group enhances its utility in various chemical reactions, such as nucleophilic additions and as a building block in the synthesis of more complex molecules. Diethyl (3-cyanopropyl)propanedioate is soluble in organic solvents, making it suitable for use in various organic reactions. Its properties, including boiling point, melting point, and density, can vary based on the specific formulation and environmental conditions. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₁₁H₁₇NO₄

InChI: InChI=1/C11H17NO4/c1-3-15-10(13)9(7-5-6-8-12)11(14)16-4-2/h9H,3-7H2,1-2H3

SMILES: CCOC(=O)C(CCCC#N)C(=O)OCC

Propanedioic acid, (3-cyanopropyl)-,diethyl ester

CAS: 63972-18-9

Formula: C₁₁H₁₇NO₄

Purity: 97%

Color and Shape: Liquid

Molecular weight: 227.2570

Ref: IN-DA0035IV

Diethyl 2-(3-cyanopropyl)malonate

CAS: 63972-18-9

Diethyl 2-(3-cyanopropyl)malonate

Formula: C₁₁H₁₇NO₄

Purity: ≥95%

Color and Shape: clear. coloruless liquid/ oil

Molecular weight: 227.26g/mol

Ref: 54-OR47892

Butyronitrile Diethyl Malonate

Controlled Product

CAS: 63972-18-9

Applications Butyronitrile Diethyl Malonate (cas# 63972-18-9) is a compound useful in organic synthesis.

Formula: C₁₁H₁₇NO₄

Color and Shape: Neat

Molecular weight: 227.26

Ref: TR-B802500

Diethyl 2-(3-cyanopropyl)malonate

CAS: 63972-18-9

Purity: 97%

Molecular weight: 227.2599945

Ref: 10-F775182