CAS 63977-32-2
:ethyl 9-fluorodecanoate
Description:
Ethyl 9-fluorodecanoate is an organic compound characterized by its ester functional group, which is formed from the reaction of decanoic acid and ethanol, with the addition of a fluorine atom at the 9th carbon position of the decanoate chain. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic decanoate chain. Ethyl 9-fluorodecanoate is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block in organic synthesis. The presence of the fluorine atom can enhance the lipophilicity and metabolic stability of the compound, making it a valuable candidate for further research. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe laboratory practices.
Formula:C12H23FO2
InChI:InChI=1/C12H23FO2/c1-3-15-12(14)10-8-6-4-5-7-9-11(2)13/h11H,3-10H2,1-2H3
SMILES:CCOC(=O)CCCCCCCC(C)F
Synonyms:- Decanoic Acid, 9-Fluoro-, Ethyl Ester
- Ethyl 9-fluorodecanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 9-fluorodecanoate
CAS:<p>Ethyl 9-fluorodecanoate is a biochemical.</p>Formula:C12H23FO2Color and Shape:SolidMolecular weight:218.31
