CAS 639807-18-4

2-(Cyclopropylamino)-3-pyridinecarboxylic acid

Description:

2-(Cyclopropylamino)-3-pyridinecarboxylic acid, with the CAS number 639807-18-4, is a chemical compound characterized by its unique structure, which includes a pyridine ring and a cyclopropylamino group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, contributing to its potential biological activity. It is likely to be a solid at room temperature, with solubility in polar solvents due to the presence of the carboxylic acid functional group. The compound may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the presence of the cyclopropyl group may impart unique steric and electronic properties, making it an interesting candidate for further research in drug design and synthesis. As with many organic compounds, safety and handling precautions should be observed, given the potential for biological activity.

Formula: C₉H₁₀N₂O₂

InChI: InChI=1S/C9H10N2O2/c12-9(13)7-2-1-5-10-8(7)11-6-3-4-6/h1-2,5-6H,3-4H2,(H,10,11)(H,12,13)

InChI key: InChIKey=QVDNJGOBMXAPSJ-UHFFFAOYSA-N

SMILES: N(C1=C(C(O)=O)C=CC=N1)C2CC2

Synonyms:

• 2-(Cyclopropylamino)-3-pyridinecarboxylic acid
• 2-(Cyclopropylamino)nicotinic acid
• 3-Pyridinecarboxylic Acid, 2-(Cyclopropylamino)-
• 2-(Cyclopropylamino)pyridine-3-carboxylic acid

2-Cyclopropylaminonicotinic acid

CAS: 639807-18-4

Formula: C₉H₁₀N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 178.1879

Ref: IN-DA00E8V7

2-Cyclopropylaminonicotinic acid

CAS: 639807-18-4

2-Cyclopropylaminonicotinic acid

Purity: 97%

Molecular weight: 178.19g/mol

Ref: 54-OR958277

2-(Cyclopropylamino)nicotinic acid

CAS: 639807-18-4

Formula: C₉H₁₀N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.191

Ref: 10-F511595