CAS 63981-22-6
:{(2E)-1-carbamoyl-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl}acetic acid
Description:
The chemical substance known as {(2E)-1-carbamoyl-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl}acetic acid, with the CAS number 63981-22-6, is a complex organic compound featuring a hydrazine derivative. It contains a carbamoyl group, which contributes to its potential as a bioactive molecule. The presence of a nitrofuran moiety suggests possible antimicrobial or antitumor activity, as nitrofuran derivatives are known for their pharmacological properties. The acetic acid component indicates that the compound is likely to exhibit acidic characteristics, which may influence its solubility and reactivity in various environments. Additionally, the E configuration of the double bond in the hydrazine structure implies specific stereochemical properties that can affect its biological interactions. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation through experimental studies.
Formula:C8H8N4O6
InChI:InChI=1/C8H8N4O6/c9-8(15)11(4-7(13)14)10-3-5-1-2-6(18-5)12(16)17/h1-3H,4H2,(H2,9,15)(H,13,14)/b10-3+
Synonyms:- 3-(5-Nitrofurfurylideneamino)Hydantoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Nitrofurantoin Related Compound A (N-(Aminocarbonyl)-N-[([5-nitro-2-furanyl]-methylene)-amino]-glycine)
CAS:Compounds containing an unfused furan ring (whether or not hydrogenated) in the structure nesoiFormula:C8H8N4O6Color and Shape:White Crystalline PowderMolecular weight:256.044383-(5-Nitrofurfurylideneamino)hydantoic Acid
CAS:Formula:C8H8N4O6Purity:95%Color and Shape:SolidMolecular weight:256.17232-(1-Carbamoyl-2-((5-nitrofuran-2-yl)methylene)hydrazinyl)acetic acid
CAS:2-(1-Carbamoyl-2-((5-nitrofuran-2-yl)methylene)hydrazinyl)acetic acidPurity:95%Molecular weight:256.17g/mol3-(5-Nitrofurfurylideneamino)hydantoic Acid
CAS:<p>Impurity Nitrofurantoin USP Related Compound A<br>Applications 3-(5-Nitrofurfurylideneamino)hydantoic Acid, is a new derivative of 5-Nitro-2-furfural, and they are proved to be bactericidal. Nitrofurantoin USP Related Compound A.<br>References Swirska, A., et al.: Rocz. Chem., 31, 1335 (1957);<br></p>Formula:C8H8N4O6Color and Shape:YellowMolecular weight:256.17






