CymitQuimica logo

CAS 63989-80-0

:

2-Decyl-5-methylphenol

Description:
2-Decyl-5-methylphenol, with the CAS number 63989-80-0, is an organic compound characterized by its phenolic structure, which includes a decyl side chain and a methyl group at specific positions on the aromatic ring. This compound typically exhibits properties associated with phenols, such as being a weak acid due to the presence of the hydroxyl (-OH) group. It is generally hydrophobic due to the long alkyl chain, which enhances its solubility in organic solvents while making it less soluble in water. 2-Decyl-5-methylphenol may possess antimicrobial and antioxidant properties, making it useful in various applications, including as a preservative or additive in formulations. Its structure allows for potential interactions with biological systems, which can be explored in fields such as pharmaceuticals or materials science. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper usage and risk management.
Formula:C17H28O
InChI:InChI=1S/C17H28O/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-17(16)18/h12-14,18H,3-11H2,1-2H3
InChI key:InChIKey=GAIKPEXWXLEOPD-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)C1=C(O)C=C(C)C=C1
Synonyms:
  • 2-Decyl-5-methylphenol
  • 3-Hydroxy-1-methyl-4-decyl-benzol
  • Phenol, 2-decyl-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.