CAS 64-47-1
:Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, 5-(N-methylcarbamate), (3aS,8aR)-, sulfate (2:1)
Description:
Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, 5-(N-methylcarbamate), (3aS,8aR)-, sulfate (2:1) is a complex organic compound characterized by its unique bicyclic structure, which includes a pyrrole and indole moiety. This compound is known for its potential biological activity, particularly in pharmacology, where it may exhibit properties such as antitumor or antimicrobial effects. The presence of the N-methylcarbamate group suggests that it may interact with biological systems through enzyme inhibition or receptor modulation. The sulfate moiety indicates that the compound may have increased solubility and bioavailability in aqueous environments. Its stereochemistry, denoted by the (3aS,8aR) configuration, is crucial for its biological activity, as the spatial arrangement of atoms can significantly influence how the molecule interacts with biological targets. Overall, this compound represents a class of substances that are of interest in medicinal chemistry and drug development due to their complex structure and potential therapeutic applications.
Formula:C15H21N3O2H2O4S
InChI:InChI=1S/C15H21N3O2.H2O4S/c1-15-7-8-17(3)13(15)18(4)12-6-5-10(9-11(12)15)20-14(19)16-2;1-5(2,3)4/h5-6,9,13H,7-8H2,1-4H3,(H,16,19);(H2,1,2,3,4)/t13-,15+;/m1./s1
InChI key:InChIKey=LLIODTIILSCNOH-PBCQUBLHSA-N
SMILES:S(=O)(=O)(O)O.C[C@]12C=3C(N(C)[C@]1(N(C)CC2)[H])=CC=C(OC(NC)=O)C3
Synonyms:- (3aS,8aR)-1,3a,8-trimethyl-1,2,3,3a,8,8a-hexahydropyrrolo[2,3-b]indol-5-yl methylcarbamate sulfate
- Eserine sulfate
- Eserine sulphate
- Physostigmine Sulphate
- Physostigmine hemisulfate
- Physostigmine sulfate
- Physostigmine, sulfate (2:1)
- Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, 5-(N-methylcarbamate), (3aS,8aR)-, sulfate (2:1)
- Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, methylcarbamate (ester), (3aS,8aR)-, sulfate (2:1) (salt)
- Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, methylcarbamate (ester), (3aS-cis)-, sulfate (2:1) (salt)
- bis{(3aS,8aS)-1,3a,8-trimethyl-5-[(methylcarbamoyl)oxy]-1,2,3,3a,8,8a-hexahydropyrrolo[2,3-b]indol-1-ium} sulfate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Physostigmine (hemisulfate)
CAS:Physostigmine (hemisulfate)Formula:C16H27N3O6SPurity:≥95%Molecular weight:389.47Eserine hemisulfate salt
CAS:Formula:C15H21N3O2·5H2SO4Purity:≥ 95% (anhydrous basis)Color and Shape:White to off-white powderMolecular weight:324.39Physostigmine Hemisulfate
CAS:Controlled ProductApplications Physostigmine Hemisulfate is a parasympathomimetic, specifically, a reversible cholinesterase inhibitor obtained from the Calabar bean, used to treat glaucoma and delayed gastric emptying.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Engelhart, L., et al.: Arch. Exp. Pathol. Pharmakol., 150, 1 (1930); Muhtadi, F.J., et al.: Anal. Profiles Drug Subs., 18, 289 (1989)Formula:C15H21N3O2·H2O4SColor and Shape:NeatMolecular weight:648.77Physostigmine hemisulfate
CAS:cholinesterase inhibitorFormula:C15H21N302H204SPurity:98%Color and Shape:SolidMolecular weight:324.39Eserine sulfate
CAS:Eserine sulfate is a cholinergic drug that has been shown to inhibit the enzyme acetylcholinesterase, leading to an accumulation of acetylcholine. This can lead to increased muscle activity and cognitive function. Eserine sulfate could be used as a potential biomarker for leukemic mice and may have cytotoxic effects on cancer cells. The compound was also shown to have significant cytotoxicity in vitro against human leukemia cells.Formula:C30H44N6O8SPurity:Min. 95%Molecular weight:648.77 g/mol







