CAS 640-01-7: 2,2,6,6-Tetramethyl-1-nitroso-4-piperidinone

Description:2,2,6,6-Tetramethyl-1-nitroso-4-piperidinone, commonly referred to as TMNP, is an organic compound characterized by its distinctive nitroso and piperidinone functional groups. It appears as a yellow to orange crystalline solid and is known for its stability under ambient conditions, although it can be sensitive to light and heat. The compound features a piperidine ring substituted with four methyl groups and a nitroso group, which contributes to its unique chemical reactivity and properties. TMNP is often utilized in organic synthesis and as a reagent in various chemical reactions, particularly in the field of polymer chemistry and as a stabilizer for certain materials. Its ability to act as a radical initiator makes it valuable in the production of polymers and other materials. Additionally, TMNP has been studied for its potential applications in medicinal chemistry, although safety precautions are necessary due to its reactive nature. Proper handling and storage are essential to maintain its integrity and prevent degradation.

Formula:C₉H₁₆N₂O₂

InChI:InChI=1S/C9H16N2O2/c1-8(2)5-7(12)6-9(3,4)11(8)10-13/h5-6H2,1-4H3

InChI key:InChIKey=PBOJDTWOZVDRPH-UHFFFAOYSA-N

SMILES:O=NN1C(C)(C)CC(=O)CC1(C)C