CAS 64018-20-8

N-benzyl-beta-alaninamide

Description:

N-benzyl-beta-alaninamide, identified by its CAS number 64018-20-8, is an organic compound characterized by the presence of a benzyl group attached to the beta-alanine structure. This compound features an amide functional group, which contributes to its chemical reactivity and potential biological activity. Typically, N-benzyl-beta-alaninamide exhibits moderate solubility in polar solvents due to the presence of the amide bond, while the benzyl group may enhance its lipophilicity. The compound may be utilized in various applications, including pharmaceuticals and biochemistry, due to its structural similarity to amino acids and potential interactions with biological systems. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions under which it is studied. As with many amides, it may participate in hydrogen bonding, influencing its physical properties and interactions with other molecules. Overall, N-benzyl-beta-alaninamide represents a versatile compound with potential implications in medicinal chemistry and related fields.

Formula: C₁₀H₁₄N₂O

InChI: InChI=1/C10H14N2O/c11-7-6-10(13)12-8-9-4-2-1-3-5-9/h1-5H,6-8,11H2,(H,12,13)

SMILES: c1ccc(cc1)CN=C(CCN)O

Synonyms:

• 3-amino-N-benzylpropanamide

3-Amino-N-benzylpropanamide

CAS: 64018-20-8

Versatile small molecule scaffold

Formula: C₁₀H₁₄N₂O

Purity: Min. 95%

Molecular weight: 178.23 g/mol

Ref: 3D-PCA01820