CAS 64028-04-2
:1,1,1,3,3,4,4,6,6,7,7,9,9,10,10,12,12,12-octadecafluoro-2,5,8,11-tetraoxadodecane
Description:
1,1,1,3,3,4,4,6,6,7,7,9,9,10,10,12,12,12-octadecafluoro-2,5,8,11-tetraoxadodecane, with CAS number 64028-04-2, is a perfluorinated compound characterized by a long carbon chain fully substituted with fluorine atoms. This structure imparts unique properties, including high thermal stability, low surface energy, and excellent chemical resistance, making it useful in various applications such as surfactants, coatings, and lubricants. The presence of multiple ether linkages contributes to its solubility in certain organic solvents while maintaining hydrophobic characteristics. Additionally, the fluorinated nature of the compound enhances its resistance to degradation, making it persistent in the environment. However, due to the potential environmental and health concerns associated with perfluorinated compounds, its use is subject to regulatory scrutiny. Overall, this compound exemplifies the balance between functional performance and environmental impact in the field of fluorinated chemicals.
Formula:C8F18O4
InChI:InChI=1/C8F18O4/c9-1(10,27-3(13,14)5(17,18)29-7(21,22)23)2(11,12)28-4(15,16)6(19,20)30-8(24,25)26
SMILES:C(C(F)(F)OC(C(F)(F)OC(F)(F)F)(F)F)(F)(F)OC(C(F)(F)OC(F)(F)F)(F)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Perfluoro-2,5,8,11-tetraoxadodecane
CAS:Perfluoro-2,5,8,11-tetraoxadodecaneFormula:C8F18O4Purity:98%Color and Shape: clear liquidMolecular weight:502.05g/mol1,1,1,3,3,4,4,6,6,7,7,9,9,10,10,12,12,12-Octadecafluoro-2,5,8,11-Tetraoxadodecane
CAS:Controlled Product<p>1,1,1,3,3,4,4,6,6,7,7,9,9,10,10,12,12-octadecafluoro-2.5.8.11-tetraoxadodecane (ODF) is a fluorinated hydrocarbon with a high molecular weight of 857 g/mol. It has an antireflection effect and is used in optical systems to reduce reflections and increase light transmission through the system. ODF has been shown to be effective in experiments for the prevention of water vapor from entering optical systems by acting as a barrier against atmospheric water vapor and other gases that can cause air bubbles inside the system. The ODF films are also less dense than polyethers and are more transparent than polyethers or perfluorinated polymers.</p>Formula:C8F18O4Purity:Min. 95%Molecular weight:502.05 g/mol

