CAS 640284-75-9

1H-pyrazolo[3,4-d]pyrimidine-3,4-diamine

Description:

1H-pyrazolo[3,4-d]pyrimidine-3,4-diamine is a heterocyclic organic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. This compound typically exhibits a solid-state form and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of amino groups at the 3 and 4 positions enhances its reactivity and solubility in polar solvents. Its structure allows for various interactions, including hydrogen bonding, which can influence its pharmacological profile. The compound may serve as a scaffold for the development of new pharmaceuticals, particularly in the context of targeting specific enzymes or receptors. Additionally, its stability and reactivity can be influenced by substituents on the ring system, making it a versatile candidate for further chemical modifications. Overall, 1H-pyrazolo[3,4-d]pyrimidine-3,4-diamine represents a significant class of compounds in the field of drug discovery and development.

Formula: C₅H₆N₆

InChI: InChI=1/C5H6N6/c6-3-2-4(7)10-11-5(2)9-1-8-3/h1H,(H5,6,7,8,9,10,11)

SMILES: c1nc(c2c(=N)[nH][nH]c2n1)N

Synonyms:

• 1H-Pyrazolo[3,4-d]pyrimidine-3,4-diamine

1H-Pyrazolo[3,4-d]pyrimidine-3,4-diamine

Controlled Product

CAS: 640284-75-9

Formula: C₅H₆N₆

Color and Shape: Neat

Molecular weight: 150.141

Ref: TR-P846930