CAS 640291-92-5

ethyl 5-(4-fluorophenyl)isoxazole-3-carboxylate

Description:

Ethyl 5-(4-fluorophenyl)isoxazole-3-carboxylate is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, enhancing the compound's potential biological activity and lipophilicity. The ethyl ester functional group contributes to its solubility properties and reactivity, making it suitable for various synthetic applications. This compound is often studied for its potential pharmacological properties, particularly in medicinal chemistry, where modifications to the isoxazole structure can lead to compounds with desirable therapeutic effects. Its molecular structure allows for interactions with biological targets, which is a key consideration in drug design. Additionally, the compound's stability, reactivity, and solubility in organic solvents are important characteristics that influence its use in research and development. Overall, ethyl 5-(4-fluorophenyl)isoxazole-3-carboxylate represents a versatile scaffold in the field of organic and medicinal chemistry.

Formula: C₁₂H₁₀FNO₃

InChI: InChI=1/C12H10FNO3/c1-2-16-12(15)10-7-11(17-14-10)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3

SMILES: CCOC(=O)c1cc(c2ccc(cc2)F)on1

Synonyms:

• 3-Isoxazolecarboxylic acid, 5-(4-fluorophenyl)-, ethyl ester
• Ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate

Ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate

CAS: 640291-92-5

Ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate

Purity: 98%

Molecular weight: 235.21g/mol

Ref: 54-PC100538

Ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate

CAS: 640291-92-5

Purity: 98%

Molecular weight: 235.2140045

Ref: 10-F669004