CAS 640291-97-0

[5-(4-fluorophenyl)isoxazol-3-yl]methanol

Description:

[5-(4-fluorophenyl)isoxazol-3-yl]methanol is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of a 4-fluorophenyl group indicates that there is a fluorine atom substituted on a phenyl ring, contributing to the compound's potential biological activity and lipophilicity. The methanol functional group (-CH2OH) suggests that the compound can participate in hydrogen bonding, which may influence its solubility and reactivity. This compound may exhibit interesting pharmacological properties due to its unique structural features, making it a candidate for research in medicinal chemistry. Its CAS number, 640291-97-0, allows for easy identification in chemical databases and literature. Overall, the combination of the isoxazole core, the fluorinated phenyl substituent, and the alcohol group provides a diverse range of chemical properties that can be explored in various applications, particularly in drug development and synthesis.

Formula: C₁₀H₈FNO₂

InChI: InChI=1/C10H8FNO2/c11-8-3-1-7(2-4-8)10-5-9(6-13)12-14-10/h1-5,13H,6H2

SMILES: c1cc(ccc1c1cc(CO)no1)F

Synonyms:

• [5-(4-Fluorophenyl)-1,2-oxazol-3-yl]methanol
• 3-Isoxazolemethanol, 5-(4-Fluorophenyl)-

5-(4-Fluorophenyl)isoxazole-3-methanol

CAS: 640291-97-0

Formula: C₁₀H₈FNO₂

Purity: 97%

Molecular weight: 193.1744

Ref: IN-DA00ED33

(5-(4-Fluorophenyl)isoxazol-3-yl)methanol

CAS: 640291-97-0

(5-(4-Fluorophenyl)isoxazol-3-yl)methanol

Purity: 99%

Molecular weight: 193.17g/mol

Ref: 54-PC904348

5-(4-Fluorophenyl)isoxazole-3-methanol

CAS: 640291-97-0

Formula: C₁₀H₈FNO₂

Purity: 97%

Molecular weight: 193.177

Ref: 10-F493990