CAS 6403-16-3
:N-L-Seryl-L-glutamic acid
Description:
N-L-Seryl-L-glutamic acid, with the CAS number 6403-16-3, is a naturally occurring amino acid derivative that plays a role in various biochemical processes. It is a dipeptide composed of serine and glutamic acid, which are both proteinogenic amino acids. This compound is characterized by its polar nature due to the presence of hydroxyl (-OH) and carboxyl (-COOH) functional groups, contributing to its solubility in water. N-L-Seryl-L-glutamic acid is involved in neurotransmission and metabolic pathways, particularly in the synthesis of proteins and neurotransmitters. Its structure allows for hydrogen bonding, which can influence its interactions with other biomolecules. Additionally, it may exhibit biological activities such as antioxidant properties and modulation of cellular signaling pathways. As with many amino acids, it is essential for various physiological functions and may have applications in nutrition and pharmaceuticals. However, specific properties such as melting point, solubility, and stability can vary based on environmental conditions and the presence of other substances.
Formula:C8H14N2O6
InChI:InChI=1S/C8H14N2O6/c9-4(3-11)7(14)10-5(8(15)16)1-2-6(12)13/h4-5,11H,1-3,9H2,(H,10,14)(H,12,13)(H,15,16)/t4-,5-/m0/s1
InChI key:InChIKey=LAFKUZYWNCHOHT-WHFBIAKZSA-N
SMILES:[C@H](NC([C@H](CO)N)=O)(CCC(O)=O)C(O)=O
Synonyms:- 161: PN: US20130123467 SEQID: 193 claimed protein
- 455: PN: WO2005081628 SEQID: 457 claimed protein
- 76: PN: US20100075891 SEQID: 76 claimed protein
- <span class="text-smallcaps">L</smallcap>-Glutamic acid, <smallcap>L</span>-seryl-
- <span class="text-smallcaps">L</smallcap>-Glutamic acid, N-<smallcap>L</span>-seryl-
- <span class="text-smallcaps">L</smallcap>-Seryl-<smallcap>L</span>-glutamic acid
- Glutamic acid, N-<span class="text-smallcaps">L</smallcap>-seryl-, <smallcap>L</span>-
- H-Ser-Glu-OH
- L-Selectin (human clone MMPLNHR_P6 fragment)
- N-<span class="text-smallcaps">L</smallcap>-Seryl-<smallcap>L</span>-glutamic acid
- Serylglutamic acid
- L-Glutamic acid, L-seryl-
- Glutamic acid, N-L-seryl-, L-
- N-L-Seryl-L-glutamic acid
- L-Glutamic acid, N-L-seryl-
- L-Seryl-L-glutamic acid
- 2-[(2-amino-3-hydroxypropanoyl)amino]pentanedioic acid
- (S)-2-((S)-2-aMino-3-hydroxypropanaMido)pentanedioic acid
- DL-Seryl-L-glutaminsaeure
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
H-Ser-Glu-OH
CAS:Bachem ID: 4010304.
Formula:C8H14N2O6Purity:>99%Color and Shape:White PowderMolecular weight:234.21(S)-2-((S)-2-Amino-3-hydroxypropanamido)pentanedioic acid
CAS:Formula:C8H14N2O6Purity:95%Color and Shape:SolidMolecular weight:234.2066L-Seryl-L-glutamic Acid
CAS:Controlled ProductFormula:C8H14N2O6Color and Shape:NeatMolecular weight:234.207H-Ser-Glu-OH
CAS:H-Ser-Glu-OH is a carbohydrate. It has been shown to be involved in the diagnosis of pancreatic cancer by binding to the peptide transporter and inhibiting its function. H-Ser-Glu-OH binds to a number of chemotactic proteins that are involved in the inflammatory response. This interaction may lead to degranulation and lysosome release, which could cause an increase in cancer cells. The carbohydrate ligand on H-Ser-Glu-OH is acidic and has functional groups that allow it to interact with other molecules in a way that is not possible for monosaccharides.
Formula:C8H14N2O6Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:234.21 g/mol



