CAS 6403-35-6
:L-Leucyl-L-proline
Description:
L-Leucyl-L-proline, with the CAS number 6403-35-6, is a dipeptide composed of the amino acids leucine and proline. It is characterized by its specific sequence, where leucine is the N-terminal amino acid and proline is the C-terminal amino acid. This dipeptide exhibits properties typical of peptides, including solubility in water and stability under physiological conditions. L-Leucyl-L-proline is known for its role in protein synthesis and may influence various biological processes, including cellular signaling and metabolism. The presence of proline in its structure can impart unique conformational properties, potentially affecting the peptide's biological activity and interactions with other biomolecules. Additionally, it may exhibit antioxidant properties and contribute to the stability of protein structures. As a dipeptide, it can be synthesized through peptide bond formation and is often studied in the context of peptide chemistry and biochemistry. Its applications may extend to nutritional supplements and therapeutic agents, particularly in the fields of sports nutrition and muscle recovery.
Formula:C11H20N2O3
InChI:InChI=1S/C11H20N2O3/c1-7(2)6-8(12)10(14)13-5-3-4-9(13)11(15)16/h7-9H,3-6,12H2,1-2H3,(H,15,16)/t8-,9-/m0/s1
InChI key:InChIKey=VTJUNIYRYIAIHF-IUCAKERBSA-N
SMILES:C([C@H](CC(C)C)N)(=O)N1[C@H](C(O)=O)CCC1
Synonyms:- 138: PN: EP2161028 PAGE: 10 claimed protein
- 18: PN: WO2021055880 SEQID: 19 claimed protein
- <span class="text-smallcaps">L</smallcap>-Leucyl-<smallcap>L</span>-proline
- <span class="text-smallcaps">L</smallcap>-Proline, 1-<smallcap>L</span>-leucyl-
- <span class="text-smallcaps">L</smallcap>-Proline, <smallcap>L</span>-leucyl-
- L-proline, L-leucyl-
- Proline, 1-<span class="text-smallcaps">L</smallcap>-leucyl-, <smallcap>L</span>-
- L-Leucyl-L-proline
- L-Proline, 1-L-leucyl-
- Proline, 1-L-leucyl-, L-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Leucylproline
CAS:Leucylproline is a peptide that proteolytic breakdown product by larger proteins.Formula:C11H20N2O3Color and Shape:SolidMolecular weight:228.29
